C28H23ClN2O5 — CID 108686832
(4E)-1-(3-chlorophenyl)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108686832) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is (4E)-1-(3-chlorophenyl)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chlorophenyl)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108686832 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | (4E)-1-(3-chlorophenyl)-4-[(2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(OC)c(/C(O)=C2\C(=O)C(=O)N(c3cccc(Cl)c3)C2c2c(C)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C28H23ClN2O5/c1-15-23(19-9-4-5-10-21(19)30-15)25-24(26(32)20-14-18(35-2)11-12-22(20)36-3)27(33)28(34)31(25)17-8-6-7-16(29)13-17/h4-14,25,30,32H,1-3H3/b26-24+ |
| InChIKey | RVKFVWYRDKPJBC-SHHOIMCASA-N |
| XLogP | 5.77 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|