C29H25ClN2O6 — CID 108686316
(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108686316) has the molecular formula C29H25ClN2O6 and a molecular weight of 532.98 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108686316 |
| Molecular Formula | C29H25ClN2O6 |
| Molecular Weight | 532.98 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | (4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(3-methoxyphenyl)-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(N2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)cc3OC)C2c2c(C)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C29H25ClN2O6/c1-15-24(18-10-5-6-11-21(18)31-15)26-25(27(33)19-13-20(30)23(38-4)14-22(19)37-3)28(34)29(35)32(26)16-8-7-9-17(12-16)36-2/h5-14,26,31,33H,1-4H3/b27-25+ |
| InChIKey | VCDQYGWNIWGFAN-IMVLJIQESA-N |
| XLogP | 5.78 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.98 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|