C27H19Cl3N2O4 — CID 108686748
(4E)-1-(4-chlorophenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108686748) has the molecular formula C27H19Cl3N2O4 and a molecular weight of 541.82 g/mol. Its IUPAC name is (4E)-1-(4-chlorophenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4-chlorophenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108686748 |
| Molecular Formula | C27H19Cl3N2O4 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | (4E)-1-(4-chlorophenyl)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1/C(O)=C1\C(=O)C(=O)N(c2ccc(Cl)cc2)C1c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C27H19Cl3N2O4/c1-13-21(17-5-3-4-6-20(17)31-13)23-22(24(33)18-11-15(29)12-19(30)26(18)36-2)25(34)27(35)32(23)16-9-7-14(28)8-10-16/h3-12,23,31,33H,1-2H3/b24-22+ |
| InChIKey | MKQQIQSKSZBJFW-ZNTNEXAZSA-N |
| XLogP | 7.07 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|