C30H27NO6 — CID 108687578
[4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687578) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is [4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687578 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2/C(=C(/O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2c2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C30H27NO6/c1-16-11-17(2)13-23(12-16)31-27(20-5-8-24(9-6-20)37-19(4)32)26(29(34)30(31)35)28(33)21-7-10-25-22(15-21)14-18(3)36-25/h5-13,15,18,27,33H,14H2,1-4H3/b28-26- |
| InChIKey | GOXLSQABVKMFTM-SGEDCAFJSA-N |
| XLogP | 5.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|