C29H27NO6 — CID 108687570
[4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687570) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is [4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687570 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [4-[(3Z)-1-(3,5-dimethylphenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(c3cc(C)cc(C)c3)C2c2ccc(OC(C)=O)cc2)cc1C |
| InChI | InChI=1S/C29H27NO6/c1-16-12-17(2)14-22(13-16)30-26(20-6-9-23(10-7-20)36-19(4)31)25(28(33)29(30)34)27(32)21-8-11-24(35-5)18(3)15-21/h6-15,26,32H,1-5H3/b27-25- |
| InChIKey | PKOIAWAJAAQIMF-RFBIWTDZSA-N |
| XLogP | 5.17 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|