C28H24ClNO6 — CID 108688032
[3-[(3Z)-3-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(3,5-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108688032) has the molecular formula C28H24ClNO6 and a molecular weight of 505.95 g/mol. Its IUPAC name is [3-[(3Z)-3-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(3,5-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3Z)-3-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(3,5-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688032 |
| Molecular Formula | C28H24ClNO6 |
| Molecular Weight | 505.95 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | [3-[(3Z)-3-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(3,5-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COc1cc(/C(O)=C2/C(=O)C(=O)N(c3cc(C)cc(C)c3)C2c2cccc(OC(C)=O)c2)ccc1Cl |
| InChI | InChI=1S/C28H24ClNO6/c1-15-10-16(2)12-20(11-15)30-25(18-6-5-7-21(13-18)36-17(3)31)24(27(33)28(30)34)26(32)19-8-9-22(29)23(14-19)35-4/h5-14,25,32H,1-4H3/b26-24- |
| InChIKey | NDCYAJNNCGHBEC-LCUIJRPUSA-N |
| XLogP | 5.52 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.95 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|