C32H33NO5 — CID 108687829
[4-[(3E)-3-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687829) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is [4-[(3E)-3-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3E)-3-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687829 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | [4-[(3E)-3-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2/C(=C(\O)c3cc(C(C)(C)C)ccc3C)C(=O)C(=O)N2c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C32H33NO5/c1-18-9-13-24(16-20(18)3)33-28(22-10-14-25(15-11-22)38-21(4)34)27(30(36)31(33)37)29(35)26-17-23(32(5,6)7)12-8-19(26)2/h8-17,28,35H,1-7H3/b29-27+ |
| InChIKey | GNZJTRJKTANVHY-ORIPQNMZSA-N |
| XLogP | 6.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|