C28H23NO7 — CID 108687825
[4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687825) has the molecular formula C28H23NO7 and a molecular weight of 485.49 g/mol. Its IUPAC name is [4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687825 |
| Molecular Formula | C28H23NO7 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [4-[(3Z)-3-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(3,4-dimethylphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2/C(=C(/O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C28H23NO7/c1-15-4-8-20(12-16(15)2)29-25(18-5-9-21(10-6-18)36-17(3)30)24(27(32)28(29)33)26(31)19-7-11-22-23(13-19)35-14-34-22/h4-13,25,31H,14H2,1-3H3/b26-24- |
| InChIKey | PSNUMUPGRCKAQD-LCUIJRPUSA-N |
| XLogP | 4.58 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|