C28H20N2O7 — CID 108687864
[4-[(3Z)-1-(4-cyanophenyl)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687864) has the molecular formula C28H20N2O7 and a molecular weight of 496.48 g/mol. Its IUPAC name is [4-[(3Z)-1-(4-cyanophenyl)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-1-(4-cyanophenyl)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687864 |
| Molecular Formula | C28H20N2O7 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | [4-[(3Z)-1-(4-cyanophenyl)-3-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2/C(=C(/O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C28H20N2O7/c1-16(31)37-21-9-4-18(5-10-21)25-24(26(32)19-6-11-22-23(14-19)36-13-12-35-22)27(33)28(34)30(25)20-7-2-17(15-29)3-8-20/h2-11,14,25,32H,12-13H2,1H3/b26-24- |
| InChIKey | RTAONJWPPNUVAX-LCUIJRPUSA-N |
| XLogP | 3.88 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|