C30H27N3O5 — CID 108675316
4-[(4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile (PubChem CID 108675316) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is 4-[(4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108675316 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 4-[(4Z)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-2,3-dioxo-5-(4-propoxyphenyl)pyrrolidin-1-yl]benzonitrile |
| SMILES | CCCOc1ccc(C2/C(=C(/O)c3ccc4c(c3)N(C)CCO4)C(=O)C(=O)N2c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C30H27N3O5/c1-3-15-37-23-11-6-20(7-12-23)27-26(28(34)21-8-13-25-24(17-21)32(2)14-16-38-25)29(35)30(36)33(27)22-9-4-19(18-31)5-10-22/h4-13,17,27,34H,3,14-16H2,1-2H3/b28-26- |
| InChIKey | VQILRHXSTVAKGO-SGEDCAFJSA-N |
| XLogP | 4.80 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|