C28H21ClN2O7 — CID 108687876
[4-[(3E)-3-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-cyanophenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687876) has the molecular formula C28H21ClN2O7 and a molecular weight of 532.94 g/mol. Its IUPAC name is [4-[(3E)-3-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-cyanophenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3E)-3-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-cyanophenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687876 |
| Molecular Formula | C28H21ClN2O7 |
| Molecular Weight | 532.94 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | [4-[(3E)-3-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-1-(4-cyanophenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | COc1cc(OC)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccc(OC(C)=O)cc2)cc1Cl |
| InChI | InChI=1S/C28H21ClN2O7/c1-15(32)38-19-10-6-17(7-11-19)25-24(26(33)20-12-21(29)23(37-3)13-22(20)36-2)27(34)28(35)31(25)18-8-4-16(14-30)5-9-18/h4-13,25,33H,1-3H3/b26-24+ |
| InChIKey | KZDLZPRNXNCJJL-SHHOIMCASA-N |
| XLogP | 4.78 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|