C26H19ClN2O5 — CID 108639456
4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzonitrile (PubChem CID 108639456) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is 4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108639456 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-[(4E)-4-[(5-chloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzonitrile |
| SMILES | COc1cc(OC)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(C#N)cc3)C2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C26H19ClN2O5/c1-33-20-13-21(34-2)19(27)12-18(20)24(30)22-23(16-6-4-3-5-7-16)29(26(32)25(22)31)17-10-8-15(14-28)9-11-17/h3-13,23,30H,1-2H3/b24-22+ |
| InChIKey | BFDPDEFYQUKRRK-ZNTNEXAZSA-N |
| XLogP | 4.86 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|