C27H20Cl2N2O6 — CID 108579612
4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108579612) has the molecular formula C27H20Cl2N2O6 and a molecular weight of 539.37 g/mol. Its IUPAC name is 4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108579612 |
| Molecular Formula | C27H20Cl2N2O6 |
| Molecular Weight | 539.37 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 4-[(3E)-3-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | COc1ccccc1C1/C(=C(\O)c2cc(Cl)c(OC)c(Cl)c2OC)C(=O)C(=O)N1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H20Cl2N2O6/c1-35-19-7-5-4-6-16(19)22-20(23(32)17-12-18(28)26(37-3)21(29)25(17)36-2)24(33)27(34)31(22)15-10-8-14(13-30)9-11-15/h4-12,22,32H,1-3H3/b23-20+ |
| InChIKey | LRFJKLCQWMMPBT-BSYVCWPDSA-N |
| XLogP | 5.52 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|