C26H18F3NO7 — CID 108708003
(4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 108708003) has the molecular formula C26H18F3NO7 and a molecular weight of 513.42 g/mol. Its IUPAC name is (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108708003 |
| Molecular Formula | C26H18F3NO7 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | (4Z)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(4-hydroxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(OC(F)(F)F)cc2)C(c2ccc(O)cc2)/C1=C(/O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H18F3NO7/c27-26(28,29)37-18-8-4-16(5-9-18)30-22(14-1-6-17(31)7-2-14)21(24(33)25(30)34)23(32)15-3-10-19-20(13-15)36-12-11-35-19/h1-10,13,22,31-32H,11-12H2/b23-21- |
| InChIKey | DYXNMQAYKWSJEW-LNVKXUELSA-N |
| XLogP | 4.69 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|