C31H25NO5 — CID 108688154
[3-[(3Z)-1-(4-ethylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108688154) has the molecular formula C31H25NO5 and a molecular weight of 491.54 g/mol. Its IUPAC name is [3-[(3Z)-1-(4-ethylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3Z)-1-(4-ethylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688154 |
| Molecular Formula | C31H25NO5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | [3-[(3Z)-1-(4-ethylphenyl)-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCc1ccc(N2C(=O)C(=O)/C(=C(\O)c3cccc4ccccc34)C2c2cccc(OC(C)=O)c2)cc1 |
| InChI | InChI=1S/C31H25NO5/c1-3-20-14-16-23(17-15-20)32-28(22-10-6-11-24(18-22)37-19(2)33)27(30(35)31(32)36)29(34)26-13-7-9-21-8-4-5-12-25(21)26/h4-18,28,34H,3H2,1-2H3/b29-27- |
| InChIKey | ZCQQGZVLQDMVNS-OHYPFYFLSA-N |
| XLogP | 5.95 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|