C29H23NO6 — CID 108688321
[3-[3-(1-benzofuran-2-carbonyl)-1-(3,4-dimethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108688321) has the molecular formula C29H23NO6 and a molecular weight of 481.50 g/mol. Its IUPAC name is [3-[3-(1-benzofuran-2-carbonyl)-1-(3,4-dimethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [3-[3-(1-benzofuran-2-carbonyl)-1-(3,4-dimethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688321 |
| Molecular Formula | C29H23NO6 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [3-[3-(1-benzofuran-2-carbonyl)-1-(3,4-dimethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C2C(C(=O)c3cc4ccccc4o3)=C(O)C(=O)N2c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C29H23NO6/c1-16-11-12-21(13-17(16)2)30-26(20-8-6-9-22(14-20)35-18(3)31)25(28(33)29(30)34)27(32)24-15-19-7-4-5-10-23(19)36-24/h4-15,26,33H,1-3H3 |
| InChIKey | CSAORTQCWOOJCC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|