C10H15N3O3S — CID 10868944
tert-butyl N-[(4-carbamoyl-1,3-thiazol-2-yl)methyl]carbamate (PubChem CID 10868944) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is tert-butyl N-[(4-carbamoyl-1,3-thiazol-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-carbamoyl-1,3-thiazol-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 10868944 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | tert-butyl N-[(4-carbamoyl-1,3-thiazol-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(C(N)=O)cs1 |
| InChI | InChI=1S/C10H15N3O3S/c1-10(2,3)16-9(15)12-4-7-13-6(5-17-7)8(11)14/h5H,4H2,1-3H3,(H2,11,14)(H,12,15) |
| InChIKey | UWJGCUCGARIICX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |