C27H23NO7 — CID 108689765
4-[[(3E)-3-[hydroxy-(2-methoxyphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108689765) has the molecular formula C27H23NO7 and a molecular weight of 473.48 g/mol. Its IUPAC name is 4-[[(3E)-3-[hydroxy-(2-methoxyphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3E)-3-[hydroxy-(2-methoxyphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108689765 |
| Molecular Formula | C27H23NO7 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-[[(3E)-3-[hydroxy-(2-methoxyphenyl)methylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | COc1ccccc1/C(O)=C1\C(=O)C(=O)N(Cc2ccc(C(=O)O)cc2)C1c1ccccc1OC |
| InChI | InChI=1S/C27H23NO7/c1-34-20-9-5-3-7-18(20)23-22(24(29)19-8-4-6-10-21(19)35-2)25(30)26(31)28(23)15-16-11-13-17(14-12-16)27(32)33/h3-14,23,29H,15H2,1-2H3,(H,32,33)/b24-22+ |
| InChIKey | IUNIHXUINZRBSN-ZNTNEXAZSA-N |
| XLogP | 4.02 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|