C30H29NO8 — CID 108689794
4-[[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108689794) has the molecular formula C30H29NO8 and a molecular weight of 531.56 g/mol. Its IUPAC name is 4-[[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108689794 |
| Molecular Formula | C30H29NO8 |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 4-[[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-2-(2-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(Cc3ccc(C(=O)O)cc3)C2c2ccccc2OC)c(OCC)c1 |
| InChI | InChI=1S/C30H29NO8/c1-4-38-20-14-15-22(24(16-20)39-5-2)27(32)25-26(21-8-6-7-9-23(21)37-3)31(29(34)28(25)33)17-18-10-12-19(13-11-18)30(35)36/h6-16,26,32H,4-5,17H2,1-3H3,(H,35,36)/b27-25+ |
| InChIKey | RFUPPJFXXNXTMC-IMVLJIQESA-N |
| XLogP | 4.81 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|