C28H25Cl2NO6 — CID 108689884
(4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione (PubChem CID 108689884) has the molecular formula C28H25Cl2NO6 and a molecular weight of 542.42 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108689884 |
| Molecular Formula | C28H25Cl2NO6 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methoxyphenyl)-1-[2-(4-methoxyphenyl)ethyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(CCN2C(=O)C(=O)/C(=C(/O)c3cc(Cl)c(OC)c(Cl)c3)C2c2ccccc2OC)cc1 |
| InChI | InChI=1S/C28H25Cl2NO6/c1-35-18-10-8-16(9-11-18)12-13-31-24(19-6-4-5-7-22(19)36-2)23(26(33)28(31)34)25(32)17-14-20(29)27(37-3)21(30)15-17/h4-11,14-15,24,32H,12-13H2,1-3H3/b25-23+ |
| InChIKey | DEQQRCORDLBURR-WJTDDFOZSA-N |
| XLogP | 5.68 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|