C24H16F3NO5S — CID 108692089
(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione (PubChem CID 108692089) has the molecular formula C24H16F3NO5S and a molecular weight of 487.46 g/mol. Its IUPAC name is (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108692089 |
| Molecular Formula | C24H16F3NO5S |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-thiophen-2-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cccc(C(F)(F)F)c2)C(c2cccs2)/C1=C(/O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H16F3NO5S/c25-24(26,27)15-4-1-3-13(9-15)11-28-20(18-5-2-8-34-18)19(22(30)23(28)31)21(29)14-6-7-16-17(10-14)33-12-32-16/h1-10,20,29H,11-12H2/b21-19- |
| InChIKey | KTRMMIHBHSDTRZ-VZCXRCSSSA-N |
| XLogP | 5.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|