C16H18O4 — CID 10869487
benzyl (1R,3aS,6aR)-1-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate (PubChem CID 10869487) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is benzyl (1R,3aS,6aR)-1-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate.
| Compound Name | benzyl (1R,3aS,6aR)-1-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
|---|---|
| PubChem CID | 10869487 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | benzyl (1R,3aS,6aR)-1-methyl-3-oxo-4,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-3a-carboxylate |
| SMILES | C[C@H]1OC(=O)[C@@]2(C(=O)OCc3ccccc3)CCC[C@@H]12 |
| InChI | InChI=1S/C16H18O4/c1-11-13-8-5-9-16(13,15(18)20-11)14(17)19-10-12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-10H2,1H3/t11-,13+,16+/m1/s1 |
| InChIKey | IUUDZDQUSPPHEH-FFSVYQOJSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|