C26H21Cl2N3O4 — CID 108695392
(4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108695392) has the molecular formula C26H21Cl2N3O4 and a molecular weight of 510.38 g/mol. Its IUPAC name is (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108695392 |
| Molecular Formula | C26H21Cl2N3O4 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | (4Z)-5-(3,4-dichlorophenyl)-4-[hydroxy-(4-methyl-2,3-dihydro-1,4-benzoxazin-6-yl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | CN1CCOc2ccc(/C(O)=C3/C(=O)C(=O)N(Cc4ccncc4)C3c3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C26H21Cl2N3O4/c1-30-10-11-35-21-5-3-17(13-20(21)30)24(32)22-23(16-2-4-18(27)19(28)12-16)31(26(34)25(22)33)14-15-6-8-29-9-7-15/h2-9,12-13,23,32H,10-11,14H2,1H3/b24-22- |
| InChIKey | QTMBANPEVMKHCQ-GYHWCHFESA-N |
| XLogP | 4.84 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|