C26H19Cl2NO5 — CID 98381288
(4E,5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione (PubChem CID 98381288) has the molecular formula C26H19Cl2NO5 and a molecular weight of 496.35 g/mol. Its IUPAC name is (4E,5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98381288 |
| Molecular Formula | C26H19Cl2NO5 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.06 |
| IUPAC Name | (4E,5S)-1-benzyl-5-(3,4-dichlorophenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccccc2)[C@@H](c2ccc(Cl)c(Cl)c2)/C1=C(\O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H19Cl2NO5/c27-18-8-6-16(12-19(18)28)23-22(24(30)17-7-9-20-21(13-17)34-11-10-33-20)25(31)26(32)29(23)14-15-4-2-1-3-5-15/h1-9,12-13,23,30H,10-11,14H2/b24-22+/t23-/m0/s1 |
| InChIKey | VNWUOLBHFDUFTF-AYWGPLOBSA-N |
| XLogP | 5.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|