C29H25NO6 — CID 108696199
methyl 4-[[(3E)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate (PubChem CID 108696199) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is methyl 4-[[(3E)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3E)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108696199 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | methyl 4-[[(3E)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(2-methylphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(/O)c3ccc4c(c3)CCO4)C2c2ccccc2C)cc1 |
| InChI | InChI=1S/C29H25NO6/c1-17-5-3-4-6-22(17)25-24(26(31)21-11-12-23-20(15-21)13-14-36-23)27(32)28(33)30(25)16-18-7-9-19(10-8-18)29(34)35-2/h3-12,15,25,31H,13-14,16H2,1-2H3/b26-24+ |
| InChIKey | TWNKQBZRODQGRG-SHHOIMCASA-N |
| XLogP | 4.34 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|