C29H30N2O6 — CID 108696240
(4Z)-1-(1-benzylpiperidin-4-yl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione (PubChem CID 108696240) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is (4Z)-1-(1-benzylpiperidin-4-yl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(1-benzylpiperidin-4-yl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108696240 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (4Z)-1-(1-benzylpiperidin-4-yl)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(C3CCN(Cc4ccccc4)CC3)C2c2ccco2)cc1OC |
| InChI | InChI=1S/C29H30N2O6/c1-35-22-11-10-20(17-24(22)36-2)27(32)25-26(23-9-6-16-37-23)31(29(34)28(25)33)21-12-14-30(15-13-21)18-19-7-4-3-5-8-19/h3-11,16-17,21,26,32H,12-15,18H2,1-2H3/b27-25- |
| InChIKey | XKUMSLXGPVZKLD-RFBIWTDZSA-N |
| XLogP | 4.38 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|