C26H22F3NO6 — CID 108696328
(4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione (PubChem CID 108696328) has the molecular formula C26H22F3NO6 and a molecular weight of 501.46 g/mol. Its IUPAC name is (4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108696328 |
| Molecular Formula | C26H22F3NO6 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (4Z)-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2/C(=O)C(=O)N(Cc3cccc(C(F)(F)F)c3)C2c2ccc(C)o2)c(OC)c1 |
| InChI | InChI=1S/C26H22F3NO6/c1-14-7-10-19(36-14)22-21(23(31)18-9-8-17(34-2)12-20(18)35-3)24(32)25(33)30(22)13-15-5-4-6-16(11-15)26(27,28)29/h4-12,22,31H,13H2,1-3H3/b23-21- |
| InChIKey | WAUNZONPEUKGMZ-LNVKXUELSA-N |
| XLogP | 5.25 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|