C26H21ClF3NO5 — CID 108696386
(4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione (PubChem CID 108696386) has the molecular formula C26H21ClF3NO5 and a molecular weight of 519.90 g/mol. Its IUPAC name is (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108696386 |
| Molecular Formula | C26H21ClF3NO5 |
| Molecular Weight | 519.90 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | (4E)-4-[(3-chloro-2-methoxy-5-methylphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(C)cc1/C(O)=C1\C(=O)C(=O)N(Cc2cccc(C(F)(F)F)c2)C1c1ccc(C)o1 |
| InChI | InChI=1S/C26H21ClF3NO5/c1-13-9-17(24(35-3)18(27)10-13)22(32)20-21(19-8-7-14(2)36-19)31(25(34)23(20)33)12-15-5-4-6-16(11-15)26(28,29)30/h4-11,21,32H,12H2,1-3H3/b22-20+ |
| InChIKey | IAQRPIDZRRETNW-LSDHQDQOSA-N |
| XLogP | 6.20 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.90 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|