C27H32N2O5 — CID 108696761
[3-[(3Z)-1-[2-(diethylamino)ethyl]-3-[(3,4-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108696761) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is [3-[(3Z)-1-[2-(diethylamino)ethyl]-3-[(3,4-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3Z)-1-[2-(diethylamino)ethyl]-3-[(3,4-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108696761 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [3-[(3Z)-1-[2-(diethylamino)ethyl]-3-[(3,4-dimethylphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCN(CC)CCN1C(=O)C(=O)/C(=C(\O)c2ccc(C)c(C)c2)C1c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C27H32N2O5/c1-6-28(7-2)13-14-29-24(20-9-8-10-22(16-20)34-19(5)30)23(26(32)27(29)33)25(31)21-12-11-17(3)18(4)15-21/h8-12,15-16,24,31H,6-7,13-14H2,1-5H3/b25-23- |
| InChIKey | ZMGDLNKSBMQQHY-BZZOAKBMSA-N |
| XLogP | 3.99 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|