C29H36N2O7 — CID 108696764
[3-[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108696764) has the molecular formula C29H36N2O7 and a molecular weight of 524.61 g/mol. Its IUPAC name is [3-[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [3-[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108696764 |
| Molecular Formula | C29H36N2O7 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | [3-[(3E)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCN(CC)CC)C2c2cccc(OC(C)=O)c2)c(OCC)c1 |
| InChI | InChI=1S/C29H36N2O7/c1-6-30(7-2)15-16-31-26(20-11-10-12-22(17-20)38-19(5)32)25(28(34)29(31)35)27(33)23-14-13-21(36-8-3)18-24(23)37-9-4/h10-14,17-18,26,33H,6-9,15-16H2,1-5H3/b27-25+ |
| InChIKey | PKEFSNFUDFVGPS-IMVLJIQESA-N |
| XLogP | 4.17 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|