C27H22N2O8 — CID 108697639
ethyl 3-[(3Z)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108697639) has the molecular formula C27H22N2O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is ethyl 3-[(3Z)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-[(3Z)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108697639 |
| Molecular Formula | C27H22N2O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | ethyl 3-[(3Z)-3-[hydroxy-(3-nitrophenyl)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3cccc([N+](=O)[O-])c3)C2c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C27H22N2O8/c1-3-37-27(33)18-7-5-8-19(15-18)28-23(16-10-12-21(36-2)13-11-16)22(25(31)26(28)32)24(30)17-6-4-9-20(14-17)29(34)35/h4-15,23,30H,3H2,1-2H3/b24-22- |
| InChIKey | RGVICXNIKUONTM-GYHWCHFESA-N |
| XLogP | 4.41 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|