C29H26N2O7 — CID 108718021
methyl 3-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108718021) has the molecular formula C29H26N2O7 and a molecular weight of 514.53 g/mol. Its IUPAC name is methyl 3-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108718021 |
| Molecular Formula | C29H26N2O7 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | methyl 3-[(3Z)-2-(4-tert-butylphenyl)-3-[hydroxy-(3-nitrophenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3cccc([N+](=O)[O-])c3)C2c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C29H26N2O7/c1-29(2,3)20-13-11-17(12-14-20)24-23(25(32)18-7-5-10-22(15-18)31(36)37)26(33)27(34)30(24)21-9-6-8-19(16-21)28(35)38-4/h5-16,24,32H,1-4H3/b25-23- |
| InChIKey | NACUKAKVZRDEQN-BZZOAKBMSA-N |
| XLogP | 5.31 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|