C27H19F3N2O5 — CID 108698691
(4Z)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 108698691) has the molecular formula C27H19F3N2O5 and a molecular weight of 508.45 g/mol. Its IUPAC name is (4Z)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108698691 |
| Molecular Formula | C27H19F3N2O5 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (4Z)-4-[hydroxy(1H-indol-3-yl)methylidene]-5-(3-methoxyphenyl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C2/C(=C(/O)c3c[nH]c4ccccc34)C(=O)C(=O)N2c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H19F3N2O5/c1-36-18-6-4-5-15(13-18)23-22(24(33)20-14-31-21-8-3-2-7-19(20)21)25(34)26(35)32(23)16-9-11-17(12-10-16)37-27(28,29)30/h2-14,23,31,33H,1H3/b24-22- |
| InChIKey | FCRLKMRZKZYKSO-GYHWCHFESA-N |
| XLogP | 5.70 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|