C27H19N3O4 — CID 108577925
4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile (PubChem CID 108577925) has the molecular formula C27H19N3O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108577925 |
| Molecular Formula | C27H19N3O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzonitrile |
| SMILES | COc1cccc(C2/C(=C(/O)c3c[nH]c4ccccc34)C(=O)C(=O)N2c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C27H19N3O4/c1-34-19-6-4-5-17(13-19)24-23(25(31)21-15-29-22-8-3-2-7-20(21)22)26(32)27(33)30(24)18-11-9-16(14-28)10-12-18/h2-13,15,24,29,31H,1H3/b25-23- |
| InChIKey | JZGBABAJJWFDHQ-BZZOAKBMSA-N |
| XLogP | 4.67 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|