C28H22N2O6 — CID 108681954
ethyl 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108681954) has the molecular formula C28H22N2O6 and a molecular weight of 482.49 g/mol. Its IUPAC name is ethyl 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108681954 |
| Molecular Formula | C28H22N2O6 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | ethyl 4-[(3Z)-3-[hydroxy(1H-indol-3-yl)methylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3c[nH]c4ccccc34)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C28H22N2O6/c1-2-36-28(35)16-10-12-18(13-11-16)30-24(17-6-5-7-19(31)14-17)23(26(33)27(30)34)25(32)21-15-29-22-9-4-3-8-20(21)22/h3-15,24,29,31-32H,2H2,1H3/b25-23- |
| InChIKey | QBHPIJGAPVXIQV-BZZOAKBMSA-N |
| XLogP | 4.68 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|