C30H27NO6 — CID 108681980
ethyl 4-[(3Z)-2-(3-hydroxyphenyl)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108681980) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is ethyl 4-[(3Z)-2-(3-hydroxyphenyl)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[(3Z)-2-(3-hydroxyphenyl)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108681980 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | ethyl 4-[(3Z)-2-(3-hydroxyphenyl)-3-[hydroxy(5,6,7,8-tetrahydronaphthalen-2-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=O)/C(=C(\O)c3ccc4c(c3)CCCC4)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C30H27NO6/c1-2-37-30(36)19-12-14-23(15-13-19)31-26(21-8-5-9-24(32)17-21)25(28(34)29(31)35)27(33)22-11-10-18-6-3-4-7-20(18)16-22/h5,8-17,26,32-33H,2-4,6-7H2,1H3/b27-25- |
| InChIKey | INWCURVDXAFAFV-RFBIWTDZSA-N |
| XLogP | 5.07 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|