C28H24Cl3NO7 — CID 108701081
(4E)-1-(3-chloro-2-methylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108701081) has the molecular formula C28H24Cl3NO7 and a molecular weight of 592.86 g/mol. Its IUPAC name is (4E)-1-(3-chloro-2-methylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chloro-2-methylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108701081 |
| Molecular Formula | C28H24Cl3NO7 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | (4E)-1-(3-chloro-2-methylphenyl)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3OC)C(=O)C(=O)N2c2cccc(Cl)c2C)cc1OC |
| InChI | InChI=1S/C28H24Cl3NO7/c1-13-16(29)7-6-8-18(13)32-23(14-9-10-19(36-2)20(11-14)37-3)21(25(34)28(32)35)24(33)15-12-17(30)27(39-5)22(31)26(15)38-4/h6-12,23,33H,1-5H3/b24-21+ |
| InChIKey | AJDPUTOWFREYRZ-DARPEHSRSA-N |
| XLogP | 6.62 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|