C31H32Cl2N2O5 — CID 108710636
(4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,3-dimethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108710636) has the molecular formula C31H32Cl2N2O5 and a molecular weight of 583.51 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,3-dimethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,3-dimethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108710636 |
| Molecular Formula | C31H32Cl2N2O5 |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2,4-dimethoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,3-dimethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3OC)C(=O)C(=O)N2c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C31H32Cl2N2O5/c1-7-34(8-2)20-14-12-19(13-15-20)26-24(27(36)21-16-22(32)30(40-6)25(33)29(21)39-5)28(37)31(38)35(26)23-11-9-10-17(3)18(23)4/h9-16,26,36H,7-8H2,1-6H3/b27-24+ |
| InChIKey | UQFXBPPRYXKPAZ-SOYKGTTHSA-N |
| XLogP | 7.10 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|