C28H24Cl2F2N2O4 — CID 108711099
(4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)pyrrolidine-2,3-dione (PubChem CID 108711099) has the molecular formula C28H24Cl2F2N2O4 and a molecular weight of 561.41 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711099 |
| Molecular Formula | C28H24Cl2F2N2O4 |
| Molecular Weight | 561.41 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(\O)c3cc(Cl)cc(Cl)c3OC)C(=O)C(=O)N2c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C28H24Cl2F2N2O4/c1-4-33(5-2)18-9-6-15(7-10-18)24-23(25(35)19-12-16(29)13-20(30)27(19)38-3)26(36)28(37)34(24)22-11-8-17(31)14-21(22)32/h6-14,24,35H,4-5H2,1-3H3/b25-23+ |
| InChIKey | YZWQCMVEYIEVNF-WJTDDFOZSA-N |
| XLogP | 6.75 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.41 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|