C32H34FNO7 — CID 108701872
(4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108701872) has the molecular formula C32H34FNO7 and a molecular weight of 563.62 g/mol. Its IUPAC name is (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108701872 |
| Molecular Formula | C32H34FNO7 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(3-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3cccc(F)c3)C2c2cc(OC)c(OC)c(OC)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C32H34FNO7/c1-8-41-23-13-12-18(14-22(23)32(2,3)4)28(35)26-27(19-15-24(38-5)30(40-7)25(16-19)39-6)34(31(37)29(26)36)21-11-9-10-20(33)17-21/h9-17,27,35H,8H2,1-7H3/b28-26+ |
| InChIKey | GIEPUVJILQMQJY-BYCLXTJYSA-N |
| XLogP | 6.17 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|