C29H28FNO7 — CID 108701920
(4E)-1-(3-fluorophenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108701920) has the molecular formula C29H28FNO7 and a molecular weight of 521.54 g/mol. Its IUPAC name is (4E)-1-(3-fluorophenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-fluorophenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108701920 |
| Molecular Formula | C29H28FNO7 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (4E)-1-(3-fluorophenyl)-4-[hydroxy-(4-propoxyphenyl)methylidene]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3cccc(F)c3)C2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H28FNO7/c1-5-13-38-21-11-9-17(10-12-21)26(32)24-25(18-14-22(35-2)28(37-4)23(15-18)36-3)31(29(34)27(24)33)20-8-6-7-19(30)16-20/h6-12,14-16,25,32H,5,13H2,1-4H3/b26-24+ |
| InChIKey | XZTNDSIPSQFSFB-SHHOIMCASA-N |
| XLogP | 5.27 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|