C26H23N3O8 — CID 108702430
(4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108702430) has the molecular formula C26H23N3O8 and a molecular weight of 505.48 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108702430 |
| Molecular Formula | C26H23N3O8 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | (4E)-4-[hydroxy-(4-nitrophenyl)methylidene]-1-(pyridin-2-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccc([N+](=O)[O-])cc3)C(=O)C(=O)N2Cc2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C26H23N3O8/c1-35-19-12-16(13-20(36-2)25(19)37-3)22-21(23(30)15-7-9-18(10-8-15)29(33)34)24(31)26(32)28(22)14-17-6-4-5-11-27-17/h4-13,22,30H,14H2,1-3H3/b23-21+ |
| InChIKey | YUBJVKVNFRZXAR-XTQSDGFTSA-N |
| XLogP | 3.64 |
| TPSA | 141.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|