C17H16O3S — CID 10870311
1-(benzenesulfonyl)-9-methyldec-9-en-1,7-diyn-3-one (PubChem CID 10870311) has the molecular formula C17H16O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-9-methyldec-9-en-1,7-diyn-3-one.
| Compound Name | 1-(benzenesulfonyl)-9-methyldec-9-en-1,7-diyn-3-one |
|---|---|
| PubChem CID | 10870311 |
| Molecular Formula | C17H16O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-(benzenesulfonyl)-9-methyldec-9-en-1,7-diyn-3-one |
| SMILES | C=C(C)C#CCCCC(=O)C#CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O3S/c1-15(2)9-5-3-6-10-16(18)13-14-21(19,20)17-11-7-4-8-12-17/h4,7-8,11-12H,1,3,6,10H2,2H3 |
| InChIKey | QQVILFRADMQQTE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|