C32H35NO6 — CID 108703187
(4Z)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-propylpyrrolidine-2,3-dione (PubChem CID 108703187) has the molecular formula C32H35NO6 and a molecular weight of 529.63 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-propylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-propylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108703187 |
| Molecular Formula | C32H35NO6 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | (4Z)-4-[hydroxy-[4-(2-methylpropoxy)phenyl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-propylpyrrolidine-2,3-dione |
| SMILES | CCCN1C(=O)C(=O)/C(=C(\O)c2ccc(OCC(C)C)cc2)C1c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H35NO6/c1-5-17-33-29(24-13-16-26(27(18-24)37-4)39-20-22-9-7-6-8-10-22)28(31(35)32(33)36)30(34)23-11-14-25(15-12-23)38-19-21(2)3/h6-16,18,21,29,34H,5,17,19-20H2,1-4H3/b30-28- |
| InChIKey | MQPGZNXFIUYGSO-HYOGKJQXSA-N |
| XLogP | 6.14 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|