C16H35FO2Si — CID 10870508
(2S,4S)-4-[ditert-butyl(fluoro)silyl]oxy-5,5-dimethylhexan-2-ol (PubChem CID 10870508) has the molecular formula C16H35FO2Si and a molecular weight of 306.54 g/mol. Its IUPAC name is (2S,4S)-4-[ditert-butyl(fluoro)silyl]oxy-5,5-dimethylhexan-2-ol.
| Compound Name | (2S,4S)-4-[ditert-butyl(fluoro)silyl]oxy-5,5-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 10870508 |
| Molecular Formula | C16H35FO2Si |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | (2S,4S)-4-[ditert-butyl(fluoro)silyl]oxy-5,5-dimethylhexan-2-ol |
| SMILES | C[C@H](O)C[C@H](O[Si](F)(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H35FO2Si/c1-12(18)11-13(14(2,3)4)19-20(17,15(5,6)7)16(8,9)10/h12-13,18H,11H2,1-10H3/t12-,13-/m0/s1 |
| InChIKey | QUCOQPXFSFXQPD-STQMWFEESA-N |
| XLogP | 5.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|