C15H33FO2Si — CID 11044552
(3S,5S)-5-[ditert-butyl(fluoro)silyl]oxy-2-methylhexan-3-ol (PubChem CID 11044552) has the molecular formula C15H33FO2Si and a molecular weight of 292.51 g/mol. Its IUPAC name is (3S,5S)-5-[ditert-butyl(fluoro)silyl]oxy-2-methylhexan-3-ol.
| Compound Name | (3S,5S)-5-[ditert-butyl(fluoro)silyl]oxy-2-methylhexan-3-ol |
|---|---|
| PubChem CID | 11044552 |
| Molecular Formula | C15H33FO2Si |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (3S,5S)-5-[ditert-butyl(fluoro)silyl]oxy-2-methylhexan-3-ol |
| SMILES | CC(C)[C@@H](O)C[C@H](C)O[Si](F)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H33FO2Si/c1-11(2)13(17)10-12(3)18-19(16,14(4,5)6)15(7,8)9/h11-13,17H,10H2,1-9H3/t12-,13-/m0/s1 |
| InChIKey | ZRHZIATWXUBQBR-STQMWFEESA-N |
| XLogP | 4.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|