C10H24O2Si — CID 5247325
5-methyl-1-trimethylsilylhexane-1,3-diol (PubChem CID 5247325) has the molecular formula C10H24O2Si and a molecular weight of 204.39 g/mol. Its IUPAC name is 5-methyl-1-trimethylsilylhexane-1,3-diol.
| Compound Name | 5-methyl-1-trimethylsilylhexane-1,3-diol |
|---|---|
| PubChem CID | 5247325 |
| Molecular Formula | C10H24O2Si |
| Molecular Weight | 204.39 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 5-methyl-1-trimethylsilylhexane-1,3-diol |
| SMILES | CC(C)CC(O)CC(O)[Si](C)(C)C |
| InChI | InChI=1S/C10H24O2Si/c1-8(2)6-9(11)7-10(12)13(3,4)5/h8-12H,6-7H2,1-5H3 |
| InChIKey | QLFSPRVSYPNEKH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|