C32H34N2O6 — CID 108706233
methyl 3-[(3E)-2-[4-(dimethylamino)phenyl]-3-[hydroxy-(4-pentoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108706233) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is methyl 3-[(3E)-2-[4-(dimethylamino)phenyl]-3-[hydroxy-(4-pentoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3E)-2-[4-(dimethylamino)phenyl]-3-[hydroxy-(4-pentoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108706233 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | methyl 3-[(3E)-2-[4-(dimethylamino)phenyl]-3-[hydroxy-(4-pentoxyphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3cccc(C(=O)OC)c3)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H34N2O6/c1-5-6-7-19-40-26-17-13-22(14-18-26)29(35)27-28(21-11-15-24(16-12-21)33(2)3)34(31(37)30(27)36)25-10-8-9-23(20-25)32(38)39-4/h8-18,20,28,35H,5-7,19H2,1-4H3/b29-27+ |
| InChIKey | LOCJFWVZMOPFAU-ORIPQNMZSA-N |
| XLogP | 5.73 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|