C31H26N2O5 — CID 108706222
methyl 3-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108706222) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is methyl 3-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 3-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108706222 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | methyl 3-[(3Z)-2-[4-(dimethylamino)phenyl]-3-[hydroxy(naphthalen-1-yl)methylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C(=O)/C(=C(\O)c3cccc4ccccc34)C2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C31H26N2O5/c1-32(2)22-16-14-20(15-17-22)27-26(28(34)25-13-7-9-19-8-4-5-12-24(19)25)29(35)30(36)33(27)23-11-6-10-21(18-23)31(37)38-3/h4-18,27,34H,1-3H3/b28-26- |
| InChIKey | WLUHCNJHDKAFLG-SGEDCAFJSA-N |
| XLogP | 5.32 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|