C28H25Cl2N3O5 — CID 108706473
N-[4-[(3E)-3-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108706473) has the molecular formula C28H25Cl2N3O5 and a molecular weight of 554.43 g/mol. Its IUPAC name is N-[4-[(3E)-3-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[(3E)-3-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108706473 |
| Molecular Formula | C28H25Cl2N3O5 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | N-[4-[(3E)-3-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-2-[4-(dimethylamino)phenyl]-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | COc1c(Cl)cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(NC(C)=O)cc3)C2c2ccc(N(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C28H25Cl2N3O5/c1-15(34)31-18-7-11-20(12-8-18)33-24(16-5-9-19(10-6-16)32(2)3)23(26(36)28(33)37)25(35)17-13-21(29)27(38-4)22(30)14-17/h5-14,24,35H,1-4H3,(H,31,34)/b25-23+ |
| InChIKey | GVJFRDCMTUNONL-WJTDDFOZSA-N |
| XLogP | 5.65 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|